Methyl adamantane-1-carboxylate - Names and Identifiers
Name | Tricyclo(3.3.1.13,7)decane-1-carboxylic acid, methyl ester
|
Synonyms | AKOS BC-0473 RARECHEM AQ TC 1002 LABOTEST-BB LT00007834 1-(Methoxycarbonyl)adamantane METHYL 1-ADAMANTANECARBOXYLATE Methyl 1-Adamantane Carboxylate Methyl adamantane-1-carboxylate 1-Adamantyl Carboxylic Acid Methyl Ester 1-ADAMANTANECARBOXYLIC ACID METHYL ESTER Adamantane-1-carboxylic acid methyl ester Adamantan-1-carboxylic acid, methyl ester 1-Adamantanecarboxylic acid, methyl ester ADAMANTANE-1-CARBOXYLIC ACID METHYL ESTER methyl tricyclo[3.3.1.1~3,7~]decane-1-carboxylate Tricyclo(3.3.1.13,7)decane-1-carboxylic acid, methyl ester tricyclo[3.3.1.1~3,7~]decane-1-carboxylic acid, methyl ester
|
CAS | 711-01-3
|
EINECS | 1592732-453-0 |
InChI | InChI=1/C12H18O2/c1-14-11(13)12-5-8-2-9(6-12)4-10(3-8)7-12/h8-10H,2-7H2,1H3 |
Methyl adamantane-1-carboxylate - Physico-chemical Properties
Molecular Formula | C12H18O2
|
Molar Mass | 194.27 |
Density | 1.130±0.06 g/cm3(Predicted) |
Melting Point | 35.0 to 39.0 °C |
Boling Point | 79°C/1mmHg(lit.) |
Flash Point | 98.9°C |
Solubility | Soluble in Chloroform, Dichloromethane and Ethyl Acetate |
Vapor Presure | 0.0277mmHg at 25°C |
Appearance | White-like solid |
Color | Off-White |
Storage Condition | Sealed in dry,2-8°C |
Sensitive | Sensitive to heat |
Refractive Index | 1.529 |
MDL | MFCD01838519 |
Methyl adamantane-1-carboxylate - Introduction
Tricyclo(3.3.1.13,7)decane-1-carboxylic acid, methyl ester is an organic compound with the chemical formula C14H24O2. The following is a description of the properties, uses, preparation and safety information of the compound:
Nature:
Tricyclo(3.3.1.13,7)decane-1-carboxylic acid, methyl ester is a colorless to light yellow liquid with a low boiling point and melting point. It has a low density and a small relative molecular mass.
Use:
Tricyclo(3.3.1.13,7)decane-1-carboxylic acid, methyl ester has many uses in the chemical and industrial fields:
1. As a chemical intermediate, it can be used to synthesize other organic compounds.
2. for organic synthesis reaction, such as esterification reaction and hydroxyl protection reaction.
3. It is used as a synthetic intermediate in drug synthesis.
4. in the fragrance industry can be used as a component of odor substances.
Preparation Method:
Tricyclo(3.3.1.13,7)decane-1-carboxylic acid, methyl ester is relatively simple and can be obtained by the following steps:
1. Starting from 1,3-cyclohexadiene, it is converted to 1-adamantanecarboxylic acid by hydrogenation.
2. esterify 1-adamantane carboxylic acid with methanol to generate Tricyclo(3.3.1.13,7)decane-1-carboxylic acid, methyl ester.
Safety Information:
Tricyclo(3.3.1.13,7)decane-1-carboxylic acid, methyl ester is generally relatively safe under correct use and storage conditions. However, the following matters still need to be noted:
1. The compound is irritating and should avoid contact with skin and eyes.
2. in use should follow good laboratory practice, wear appropriate protective equipment, such as gloves and goggles, etc.
3. Avoid contact with oxygen and strong oxidants during storage to avoid the risk of fire and explosion.
4. in the process to avoid toxic gases or steam, keep good ventilation.
5. in the waste disposal should follow the local and national regulations, adopt appropriate waste disposal methods.
Please note that the use and handling of chemicals should follow safe operating procedures, and refer to the safety data sheet of chemicals and relevant regulations.
Last Update:2024-04-09 19:05:51